C22H24IN3O3 — CID 4532137
1-(4-iodophenyl)-3-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 4532137) has the molecular formula C22H24IN3O3 and a molecular weight of 505.36 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 1-(4-iodophenyl)-3-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 4532137 |
| Molecular Formula | C22H24IN3O3 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 1-(4-iodophenyl)-3-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | COc1cc(-c2nn(-c3ccc(I)cc3)c3c2CCCCN3)cc(OC)c1OC |
| InChI | InChI=1S/C22H24IN3O3/c1-27-18-12-14(13-19(28-2)21(18)29-3)20-17-6-4-5-11-24-22(17)26(25-20)16-9-7-15(23)8-10-16/h7-10,12-13,24H,4-6,11H2,1-3H3 |
| InChIKey | LLWOPOCADIPWKD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|