C24H24Cl2N2O3 — CID 3925618
2-[4-[(5-chloro-2-methylanilino)methyl]-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 3925618) has the molecular formula C24H24Cl2N2O3 and a molecular weight of 459.37 g/mol. Its IUPAC name is 2-[4-[(5-chloro-2-methylanilino)methyl]-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[(5-chloro-2-methylanilino)methyl]-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 3925618 |
| Molecular Formula | C24H24Cl2N2O3 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[4-[(5-chloro-2-methylanilino)methyl]-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | CCOc1cc(CNc2cc(Cl)ccc2C)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H24Cl2N2O3/c1-3-30-23-12-17(14-27-21-13-18(25)10-8-16(21)2)9-11-22(23)31-15-24(29)28-20-7-5-4-6-19(20)26/h4-13,27H,3,14-15H2,1-2H3,(H,28,29) |
| InChIKey | XILPDUVWNPVVKJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |