C22H19Cl3N2O2 — CID 4684440
2-[2-chloro-4-[(3-chloro-2-methylanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 4684440) has the molecular formula C22H19Cl3N2O2 and a molecular weight of 449.77 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3-chloro-2-methylanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(3-chloro-2-methylanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4684440 |
| Molecular Formula | C22H19Cl3N2O2 |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[2-chloro-4-[(3-chloro-2-methylanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1NCc1ccc(OCC(=O)Nc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl3N2O2/c1-14-16(23)6-4-8-19(14)26-12-15-9-10-21(18(25)11-15)29-13-22(28)27-20-7-3-2-5-17(20)24/h2-11,26H,12-13H2,1H3,(H,27,28) |
| InChIKey | IBEMGJLLSSQUKP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |