C22H20BrClN2O3 — CID 126381021
2-[2-bromo-4-[(4-methoxyanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 126381021) has the molecular formula C22H20BrClN2O3 and a molecular weight of 475.77 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4-methoxyanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(4-methoxyanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126381021 |
| Molecular Formula | C22H20BrClN2O3 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 2-[2-bromo-4-[(4-methoxyanilino)methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | COc1ccc(NCc2ccc(OCC(=O)Nc3ccccc3Cl)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H20BrClN2O3/c1-28-17-9-7-16(8-10-17)25-13-15-6-11-21(18(23)12-15)29-14-22(27)26-20-5-3-2-4-19(20)24/h2-12,25H,13-14H2,1H3,(H,26,27) |
| InChIKey | YAQWPZLWEQPZRK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|