C28H25BrN2O3 — CID 126383789
2-[2-bromo-4-[(4-phenoxyanilino)methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126383789) has the molecular formula C28H25BrN2O3 and a molecular weight of 517.42 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4-phenoxyanilino)methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(4-phenoxyanilino)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126383789 |
| Molecular Formula | C28H25BrN2O3 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 2-[2-bromo-4-[(4-phenoxyanilino)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(CNc2ccc(Oc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C28H25BrN2O3/c1-20-7-5-6-10-26(20)31-28(32)19-33-27-16-11-21(17-25(27)29)18-30-22-12-14-24(15-13-22)34-23-8-3-2-4-9-23/h2-17,30H,18-19H2,1H3,(H,31,32) |
| InChIKey | VLTXOKNLIKZSKZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |