C21H21N3O5 — CID 39268281
ethyl 2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenoxy]acetate (PubChem CID 39268281) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 39268281 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)Cn2cnc3c(C)cccc3c2=O)c1 |
| InChI | InChI=1S/C21H21N3O5/c1-3-28-19(26)12-29-16-8-5-7-15(10-16)23-18(25)11-24-13-22-20-14(2)6-4-9-17(20)21(24)27/h4-10,13H,3,11-12H2,1-2H3,(H,23,25) |
| InChIKey | FNKZPQFUSWFDFZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |