C27H21N3O4 — CID 46633235
methyl 3-[2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenyl]ethynyl]benzoate (PubChem CID 46633235) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 46633235 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl 3-[2-[3-[[2-(8-methyl-4-oxoquinazolin-3-yl)acetyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)Cn3cnc4c(C)cccc4c3=O)c2)c1 |
| InChI | InChI=1S/C27H21N3O4/c1-18-6-3-11-23-25(18)28-17-30(26(23)32)16-24(31)29-22-10-5-8-20(15-22)13-12-19-7-4-9-21(14-19)27(33)34-2/h3-11,14-15,17H,16H2,1-2H3,(H,29,31) |
| InChIKey | DYMZWKHSWKNDAZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|