C14H20N2O5 — CID 39288827
2-[[3-[[ethyl(2-hydroxyethyl)amino]methoxy]benzoyl]amino]acetic acid (PubChem CID 39288827) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[[3-[[ethyl(2-hydroxyethyl)amino]methoxy]benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[ethyl(2-hydroxyethyl)amino]methoxy]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 39288827 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[3-[[ethyl(2-hydroxyethyl)amino]methoxy]benzoyl]amino]acetic acid |
| SMILES | CCN(CCO)COc1cccc(C(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-2-16(6-7-17)10-21-12-5-3-4-11(8-12)14(20)15-9-13(18)19/h3-5,8,17H,2,6-7,9-10H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | BFCXPONJJJMHKF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|