C30H25NO3 — CID 3929787
phenacyl 4-benzylidene-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 3929787) has the molecular formula C30H25NO3 and a molecular weight of 447.53 g/mol. Its IUPAC name is phenacyl 4-benzylidene-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | phenacyl 4-benzylidene-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 3929787 |
| Molecular Formula | C30H25NO3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | phenacyl 4-benzylidene-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CC1CC(=Cc2ccccc2)c2nc3ccccc3c(C(=O)OCC(=O)c3ccccc3)c2C1 |
| InChI | InChI=1S/C30H25NO3/c1-20-16-23(18-21-10-4-2-5-11-21)29-25(17-20)28(24-14-8-9-15-26(24)31-29)30(33)34-19-27(32)22-12-6-3-7-13-22/h2-15,18,20H,16-17,19H2,1H3 |
| InChIKey | OQYXYZYGLGWERQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |