C19H16BrFN2O2 — CID 39318329
2-(4-bromo-2-fluorophenoxy)-N-(2-quinolin-8-ylethyl)acetamide (PubChem CID 39318329) has the molecular formula C19H16BrFN2O2 and a molecular weight of 403.25 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-(2-quinolin-8-ylethyl)acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-(2-quinolin-8-ylethyl)acetamide |
|---|---|
| PubChem CID | 39318329 |
| Molecular Formula | C19H16BrFN2O2 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-(2-quinolin-8-ylethyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1F)NCCc1cccc2cccnc12 |
| InChI | InChI=1S/C19H16BrFN2O2/c20-15-6-7-17(16(21)11-15)25-12-18(24)22-10-8-14-4-1-3-13-5-2-9-23-19(13)14/h1-7,9,11H,8,10,12H2,(H,22,24) |
| InChIKey | PTZSYAFTRMXANJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |