C15H15N5O4S — CID 39341335
ethyl 2-[10,12-dioxo-11-(1,2,4-triazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-9-yl]acetate (PubChem CID 39341335) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is ethyl 2-[10,12-dioxo-11-(1,2,4-triazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-9-yl]acetate.
| Compound Name | ethyl 2-[10,12-dioxo-11-(1,2,4-triazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-9-yl]acetate |
|---|---|
| PubChem CID | 39341335 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | ethyl 2-[10,12-dioxo-11-(1,2,4-triazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-dien-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)n(-n2cnnc2)c(=O)c2c3c(sc21)CCC3 |
| InChI | InChI=1S/C15H15N5O4S/c1-2-24-11(21)6-19-14-12(9-4-3-5-10(9)25-14)13(22)20(15(19)23)18-7-16-17-8-18/h7-8H,2-6H2,1H3 |
| InChIKey | SRJNKTYVRDUVEL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |