C21H28N2O5S — CID 42582229
ethyl 2-[3-[(4S)-2,2-dimethyloxan-4-yl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetate (PubChem CID 42582229) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is ethyl 2-[3-[(4S)-2,2-dimethyloxan-4-yl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(4S)-2,2-dimethyloxan-4-yl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 42582229 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 2-[3-[(4S)-2,2-dimethyloxan-4-yl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)n([C@H]2CCOC(C)(C)C2)c(=O)c2c3c(sc21)CCCC3 |
| InChI | InChI=1S/C21H28N2O5S/c1-4-27-16(24)12-22-19-17(14-7-5-6-8-15(14)29-19)18(25)23(20(22)26)13-9-10-28-21(2,3)11-13/h13H,4-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | FOZGOMNNEYUOLB-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |