C17H17N3O3S — CID 39342546
N-(2,4-dimethoxyphenyl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 39342546) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 39342546 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2cnc(-n3cccc3)s2)c(OC)c1 |
| InChI | InChI=1S/C17H17N3O3S/c1-22-12-5-6-14(15(9-12)23-2)19-16(21)10-13-11-18-17(24-13)20-7-3-4-8-20/h3-9,11H,10H2,1-2H3,(H,19,21) |
| InChIKey | PAQJACKXZGWLGQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |