C13H17N3 — CID 39346167
(3,7-diethylquinolin-2-yl)hydrazine (PubChem CID 39346167) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (3,7-diethylquinolin-2-yl)hydrazine.
| Compound Name | (3,7-diethylquinolin-2-yl)hydrazine |
|---|---|
| PubChem CID | 39346167 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3,7-diethylquinolin-2-yl)hydrazine |
| SMILES | CCc1ccc2cc(CC)c(NN)nc2c1 |
| InChI | InChI=1S/C13H17N3/c1-3-9-5-6-11-8-10(4-2)13(16-14)15-12(11)7-9/h5-8H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | LUZRGTUQPNGDAK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|