C13H17N3O2 — CID 62245819
[3-(ethoxymethyl)-7-methoxyquinolin-2-yl]hydrazine (PubChem CID 62245819) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is [3-(ethoxymethyl)-7-methoxyquinolin-2-yl]hydrazine.
| Compound Name | [3-(ethoxymethyl)-7-methoxyquinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 62245819 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | [3-(ethoxymethyl)-7-methoxyquinolin-2-yl]hydrazine |
| SMILES | CCOCc1cc2ccc(OC)cc2nc1NN |
| InChI | InChI=1S/C13H17N3O2/c1-3-18-8-10-6-9-4-5-11(17-2)7-12(9)15-13(10)16-14/h4-7H,3,8,14H2,1-2H3,(H,15,16) |
| InChIKey | NKDUYQYEGWPVRD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|