C16H22N2O2 — CID 62188180
3-(butan-2-yloxymethyl)-7-methoxy-N-methylquinolin-2-amine (PubChem CID 62188180) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-(butan-2-yloxymethyl)-7-methoxy-N-methylquinolin-2-amine.
| Compound Name | 3-(butan-2-yloxymethyl)-7-methoxy-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 62188180 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-(butan-2-yloxymethyl)-7-methoxy-N-methylquinolin-2-amine |
| SMILES | CCC(C)OCc1cc2ccc(OC)cc2nc1NC |
| InChI | InChI=1S/C16H22N2O2/c1-5-11(2)20-10-13-8-12-6-7-14(19-4)9-15(12)18-16(13)17-3/h6-9,11H,5,10H2,1-4H3,(H,17,18) |
| InChIKey | MZFHHIRPDBQAFU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |