C14H13ClN2 — CID 39348499
1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrole-3-carbonitrile (PubChem CID 39348499) has the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrole-3-carbonitrile.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 39348499 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrole-3-carbonitrile |
| SMILES | Cc1ccc(Cl)cc1-n1c(C)cc(C#N)c1C |
| InChI | InChI=1S/C14H13ClN2/c1-9-4-5-13(15)7-14(9)17-10(2)6-12(8-16)11(17)3/h4-7H,1-3H3 |
| InChIKey | QKGYUZDJFQNTBD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|