C13H18N6O — CID 39350414
N-(2-methoxyethyl)-2-pyrrolidin-1-ylpteridin-4-amine (PubChem CID 39350414) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-pyrrolidin-1-ylpteridin-4-amine.
| Compound Name | N-(2-methoxyethyl)-2-pyrrolidin-1-ylpteridin-4-amine |
|---|---|
| PubChem CID | 39350414 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-pyrrolidin-1-ylpteridin-4-amine |
| SMILES | COCCNc1nc(N2CCCC2)nc2nccnc12 |
| InChI | InChI=1S/C13H18N6O/c1-20-9-6-16-12-10-11(15-5-4-14-10)17-13(18-12)19-7-2-3-8-19/h4-5H,2-3,6-9H2,1H3,(H,15,16,17,18) |
| InChIKey | PVKVJAWVZGDIRK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|