About 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid
2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 39362994) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid.
Analyze 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid (CID 39362994) is 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid is COc1ccccc1-c1nc(C)sc1CC(=O)O.
What is the InChIKey of 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid?
The InChIKey is HVCZRTVGENPQEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-8-14-13(11(18-8)7-12(15)16)9-5-3-4-6-10(9)17-2/h3-6H,7H2,1-2H3,(H,15,16).
What are the key properties of 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid?
2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid has a molecular weight of 263.32 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 39362994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).