C21H21NO4S — CID 2129174
(2,6-dimethoxyphenyl) 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate (PubChem CID 2129174) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate.
| Compound Name | (2,6-dimethoxyphenyl) 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 2129174 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2,6-dimethoxyphenyl) 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate |
| SMILES | COc1cccc(OC)c1OC(=O)Cc1sc(C)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-13-8-10-15(11-9-13)20-18(27-14(2)22-20)12-19(23)26-21-16(24-3)6-5-7-17(21)25-4/h5-11H,12H2,1-4H3 |
| InChIKey | VGNOFKBSSVUTDV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|