C18H14NO3S- — CID 7303255
2-[2-methyl-4-(4-phenoxyphenyl)-1,3-thiazol-5-yl]acetate (PubChem CID 7303255) has the molecular formula C18H14NO3S- and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[2-methyl-4-(4-phenoxyphenyl)-1,3-thiazol-5-yl]acetate.
| Compound Name | 2-[2-methyl-4-(4-phenoxyphenyl)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 7303255 |
| Molecular Formula | C18H14NO3S- |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[2-methyl-4-(4-phenoxyphenyl)-1,3-thiazol-5-yl]acetate |
| SMILES | Cc1nc(-c2ccc(Oc3ccccc3)cc2)c(CC(=O)[O-])s1 |
| InChI | InChI=1S/C18H15NO3S/c1-12-19-18(16(23-12)11-17(20)21)13-7-9-15(10-8-13)22-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,20,21)/p-1 |
| InChIKey | ILVJMLSKFFGWPF-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |