C17H13N2O2S- — CID 140695284
2-(2-benzyl-4-pyridin-4-yl-1,3-thiazol-5-yl)acetate (PubChem CID 140695284) has the molecular formula C17H13N2O2S- and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(2-benzyl-4-pyridin-4-yl-1,3-thiazol-5-yl)acetate.
| Compound Name | 2-(2-benzyl-4-pyridin-4-yl-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 140695284 |
| Molecular Formula | C17H13N2O2S- |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(2-benzyl-4-pyridin-4-yl-1,3-thiazol-5-yl)acetate |
| SMILES | O=C([O-])Cc1sc(Cc2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C17H14N2O2S/c20-16(21)11-14-17(13-6-8-18-9-7-13)19-15(22-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,21)/p-1 |
| InChIKey | PBMFGAVGFPCOKF-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |