2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid

C15H15NO2S — CID 82436091

IUPAC2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1sc(Cc2ccccc2)nc1C1CC1
InChIInChI=1S/C15H15NO2S/c17-14(18)9-12-15(11-6-7-11)16-13(19-12)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,18)
InChIKeyMLVFAUJHWGROTN-UHFFFAOYSA-N
MW273.36 g/mol
LogP3.24
Rot. Bonds5

About 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid

2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82436091) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid
PubChem CID82436091
Molecular FormulaC15H15NO2S
Molecular Weight273.36 g/mol
Exact Mass273.08
IUPAC Name2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1sc(Cc2ccccc2)nc1C1CC1
InChIInChI=1S/C15H15NO2S/c17-14(18)9-12-15(11-6-7-11)16-13(19-12)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,18)
InChIKeyMLVFAUJHWGROTN-UHFFFAOYSA-N
XLogP3.24
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.36
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid?
The IUPAC name of 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid (CID 82436091) is 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid is O=C(O)Cc1sc(Cc2ccccc2)nc1C1CC1.
What is the InChIKey of 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid?
The InChIKey is MLVFAUJHWGROTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c17-14(18)9-12-15(11-6-7-11)16-13(19-12)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,18).
What are the key properties of 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid?
2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid has a molecular weight of 273.36 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82436091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).