C14H13NO2S — CID 82436026
2-(4-cyclopropyl-2-phenyl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82436026) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(4-cyclopropyl-2-phenyl-1,3-thiazol-5-yl)acetic acid.
| Compound Name | 2-(4-cyclopropyl-2-phenyl-1,3-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 82436026 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(4-cyclopropyl-2-phenyl-1,3-thiazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1sc(-c2ccccc2)nc1C1CC1 |
| InChI | InChI=1S/C14H13NO2S/c16-12(17)8-11-13(9-6-7-9)15-14(18-11)10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,16,17) |
| InChIKey | OGPNUMAQYXWXOE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |