2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid

C11H8BrNO2S — CID 19800550

IUPAC2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1nc(-c2ccccc2)sc1Br
InChIInChI=1S/C11H8BrNO2S/c12-10-8(6-9(14)15)13-11(16-10)7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15)
InChIKeySGEREEYLMJTVOM-UHFFFAOYSA-N
MW298.16 g/mol
LogP3.20
Rot. Bonds3

About 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid

2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 19800550) has the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. Its IUPAC name is 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid
PubChem CID19800550
Molecular FormulaC11H8BrNO2S
Molecular Weight298.16 g/mol
Exact Mass296.95
IUPAC Name2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1nc(-c2ccccc2)sc1Br
InChIInChI=1S/C11H8BrNO2S/c12-10-8(6-9(14)15)13-11(16-10)7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15)
InChIKeySGEREEYLMJTVOM-UHFFFAOYSA-N
XLogP3.20
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.16
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid (CID 19800550) is 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid is O=C(O)Cc1nc(-c2ccccc2)sc1Br.
What is the InChIKey of 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid?
The InChIKey is SGEREEYLMJTVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO2S/c12-10-8(6-9(14)15)13-11(16-10)7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15).
What are the key properties of 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid?
2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid has a molecular weight of 298.16 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 19800550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).