C12H10BrNO2S — CID 148550494
methyl 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetate (PubChem CID 148550494) has the molecular formula C12H10BrNO2S and a molecular weight of 312.19 g/mol. Its IUPAC name is methyl 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetate.
| Compound Name | methyl 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 148550494 |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | methyl 2-(5-bromo-2-phenyl-1,3-thiazol-4-yl)acetate |
| SMILES | COC(=O)Cc1nc(-c2ccccc2)sc1Br |
| InChI | InChI=1S/C12H10BrNO2S/c1-16-10(15)7-9-11(13)17-12(14-9)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | HLBXXXAERMQGHJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |