2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid

C11H7BrClNO2S — CID 70373613

IUPAC2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1nc(-c2ccccc2Cl)sc1Br
InChIInChI=1S/C11H7BrClNO2S/c12-10-8(5-9(15)16)14-11(17-10)6-3-1-2-4-7(6)13/h1-4H,5H2,(H,15,16)
InChIKeyJJHFVFJYZJXXFJ-UHFFFAOYSA-N
MW332.61 g/mol
LogP3.85
Rot. Bonds3

About 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid

2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 70373613) has the molecular formula C11H7BrClNO2S and a molecular weight of 332.61 g/mol. Its IUPAC name is 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
PubChem CID70373613
Molecular FormulaC11H7BrClNO2S
Molecular Weight332.61 g/mol
Exact Mass330.91
IUPAC Name2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1nc(-c2ccccc2Cl)sc1Br
InChIInChI=1S/C11H7BrClNO2S/c12-10-8(5-9(15)16)14-11(17-10)6-3-1-2-4-7(6)13/h1-4H,5H2,(H,15,16)
InChIKeyJJHFVFJYZJXXFJ-UHFFFAOYSA-N
XLogP3.85
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.61
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (CID 70373613) is 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1nc(-c2ccccc2Cl)sc1Br.
What is the InChIKey of 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is JJHFVFJYZJXXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrClNO2S/c12-10-8(5-9(15)16)14-11(17-10)6-3-1-2-4-7(6)13/h1-4H,5H2,(H,15,16).
What are the key properties of 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 332.61 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 70373613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).