C11H7BrClNO2S — CID 70373613
2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 70373613) has the molecular formula C11H7BrClNO2S and a molecular weight of 332.61 g/mol. Its IUPAC name is 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 70373613 |
| Molecular Formula | C11H7BrClNO2S |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | 2-[5-bromo-2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1nc(-c2ccccc2Cl)sc1Br |
| InChI | InChI=1S/C11H7BrClNO2S/c12-10-8(5-9(15)16)14-11(17-10)6-3-1-2-4-7(6)13/h1-4H,5H2,(H,15,16) |
| InChIKey | JJHFVFJYZJXXFJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |