C12H9BrClNO2S — CID 148550488
methyl 2-[5-bromo-2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 148550488) has the molecular formula C12H9BrClNO2S and a molecular weight of 346.63 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[5-bromo-2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 148550488 |
| Molecular Formula | C12H9BrClNO2S |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | methyl 2-[5-bromo-2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1nc(-c2cccc(Cl)c2)sc1Br |
| InChI | InChI=1S/C12H9BrClNO2S/c1-17-10(16)6-9-11(13)18-12(15-9)7-3-2-4-8(14)5-7/h2-5H,6H2,1H3 |
| InChIKey | RKWSIQBAIWZZQG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |