C15H14N2S — CID 82436090
2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetonitrile (PubChem CID 82436090) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetonitrile.
| Compound Name | 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 82436090 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(2-benzyl-4-cyclopropyl-1,3-thiazol-5-yl)acetonitrile |
| SMILES | N#CCc1sc(Cc2ccccc2)nc1C1CC1 |
| InChI | InChI=1S/C15H14N2S/c16-9-8-13-15(12-6-7-12)17-14(18-13)10-11-4-2-1-3-5-11/h1-5,12H,6-8,10H2 |
| InChIKey | SJYWOBPGWGNKMK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |