C12H16N4S2 — CID 3936498
1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 3936498) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3936498 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(NCCCn1ccnc1)NCc1cccs1 |
| InChI | InChI=1S/C12H16N4S2/c17-12(15-9-11-3-1-8-18-11)14-4-2-6-16-7-5-13-10-16/h1,3,5,7-8,10H,2,4,6,9H2,(H2,14,15,17) |
| InChIKey | OAYAUZABFOBVGJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|