C16H19N3O — CID 39368333
3-amino-N-(4-methylphenyl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 39368333) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-amino-N-(4-methylphenyl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-amino-N-(4-methylphenyl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 39368333 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-amino-N-(4-methylphenyl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | Cc1ccc(N(Cc2cccnc2)C(=O)CCN)cc1 |
| InChI | InChI=1S/C16H19N3O/c1-13-4-6-15(7-5-13)19(16(20)8-9-17)12-14-3-2-10-18-11-14/h2-7,10-11H,8-9,12,17H2,1H3 |
| InChIKey | UBNAIOYTOMMGEL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |