C19H16IN3O4 — CID 3937118
methyl 2-[[1-[hydroxy-(3-iodophenyl)methyl]pyrazole-3-carbonyl]amino]benzoate (PubChem CID 3937118) has the molecular formula C19H16IN3O4 and a molecular weight of 477.26 g/mol. Its IUPAC name is methyl 2-[[1-[hydroxy-(3-iodophenyl)methyl]pyrazole-3-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-[hydroxy-(3-iodophenyl)methyl]pyrazole-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3937118 |
| Molecular Formula | C19H16IN3O4 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | methyl 2-[[1-[hydroxy-(3-iodophenyl)methyl]pyrazole-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccn(C(O)c2cccc(I)c2)n1 |
| InChI | InChI=1S/C19H16IN3O4/c1-27-19(26)14-7-2-3-8-15(14)21-17(24)16-9-10-23(22-16)18(25)12-5-4-6-13(20)11-12/h2-11,18,25H,1H3,(H,21,24) |
| InChIKey | HNMZBICYFWLEOI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|