C13H14N2O3S — CID 39377180
O-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1,3-thiazol-2-yl]methyl]hydroxylamine (PubChem CID 39377180) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is O-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1,3-thiazol-2-yl]methyl]hydroxylamine.
| Compound Name | O-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1,3-thiazol-2-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 39377180 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | O-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1,3-thiazol-2-yl]methyl]hydroxylamine |
| SMILES | Cc1sc(CON)nc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H14N2O3S/c1-8-13(15-12(19-8)7-18-14)9-2-3-10-11(6-9)17-5-4-16-10/h2-3,6H,4-5,7,14H2,1H3 |
| InChIKey | HKJPGKFRNWMRPM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|