C20H17N3O6S3 — CID 39378497
N-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide (PubChem CID 39378497) has the molecular formula C20H17N3O6S3 and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 39378497 |
| Molecular Formula | C20H17N3O6S3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)/C(=C/c3ccc(SCCO)c([N+](=O)[O-])c3)SC2=S)cc1 |
| InChI | InChI=1S/C20H17N3O6S3/c1-29-14-5-3-13(4-6-14)18(25)21-22-19(26)17(32-20(22)30)11-12-2-7-16(31-9-8-24)15(10-12)23(27)28/h2-7,10-11,24H,8-9H2,1H3,(H,21,25)/b17-11- |
| InChIKey | ZFLUEJMENIHVRH-BOPFTXTBSA-N |
| XLogP | 3.23 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|