C14H20N4O3 — CID 39388369
1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-(4-nitrophenyl)urea (PubChem CID 39388369) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 39388369 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-(4-nitrophenyl)urea |
| SMILES | C[C@@H]1CCC[C@H](C)N1NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-10-4-3-5-11(2)17(10)16-14(19)15-12-6-8-13(9-7-12)18(20)21/h6-11H,3-5H2,1-2H3,(H2,15,16,19)/t10-,11+ |
| InChIKey | IWCMSWXSVQKXQV-PHIMTYICSA-N |
| XLogP | 2.89 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|