C17H21N3O3 — CID 95242282
1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(2-oxochromen-6-yl)urea (PubChem CID 95242282) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(2-oxochromen-6-yl)urea.
| Compound Name | 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(2-oxochromen-6-yl)urea |
|---|---|
| PubChem CID | 95242282 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(2-oxochromen-6-yl)urea |
| SMILES | C[C@@H]1CCC[C@H](C)N1NC(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-4-3-5-12(2)20(11)19-17(22)18-14-7-8-15-13(10-14)6-9-16(21)23-15/h6-12H,3-5H2,1-2H3,(H2,18,19,22)/t11-,12+ |
| InChIKey | JXZARZAIYDFYJY-TXEJJXNPSA-N |
| XLogP | 3.09 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|