C22H29N3O5S — CID 20629589
3-(tert-butylsulfonylamino)-N-(2-oxochromen-6-yl)-9-azabicyclo[3.3.1]nonane-9-carboxamide (PubChem CID 20629589) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-(tert-butylsulfonylamino)-N-(2-oxochromen-6-yl)-9-azabicyclo[3.3.1]nonane-9-carboxamide.
| Compound Name | 3-(tert-butylsulfonylamino)-N-(2-oxochromen-6-yl)-9-azabicyclo[3.3.1]nonane-9-carboxamide |
|---|---|
| PubChem CID | 20629589 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-(tert-butylsulfonylamino)-N-(2-oxochromen-6-yl)-9-azabicyclo[3.3.1]nonane-9-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CC2CCCC(C1)N2C(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-22(2,3)31(28,29)24-16-12-17-5-4-6-18(13-16)25(17)21(27)23-15-8-9-19-14(11-15)7-10-20(26)30-19/h7-11,16-18,24H,4-6,12-13H2,1-3H3,(H,23,27) |
| InChIKey | RXMQVOBETXPGQB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|