C23H24N2O5S — CID 60522629
N-(2-oxochromen-6-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 60522629) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-(2-oxochromen-6-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-oxochromen-6-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60522629 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(2-oxochromen-6-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)Nc2ccc3oc(=O)ccc3c2)c(C)c1 |
| InChI | InChI=1S/C23H24N2O5S/c1-14-11-15(2)22(16(3)12-14)31(28,29)25-10-4-5-19(25)23(27)24-18-7-8-20-17(13-18)6-9-21(26)30-20/h6-9,11-13,19H,4-5,10H2,1-3H3,(H,24,27) |
| InChIKey | ATQJQEAFSRESOB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|