C19H24N2O3 — CID 99808304
(4R)-N-(2-oxochromen-6-yl)-4-propan-2-ylazepane-1-carboxamide (PubChem CID 99808304) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (4R)-N-(2-oxochromen-6-yl)-4-propan-2-ylazepane-1-carboxamide.
| Compound Name | (4R)-N-(2-oxochromen-6-yl)-4-propan-2-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 99808304 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (4R)-N-(2-oxochromen-6-yl)-4-propan-2-ylazepane-1-carboxamide |
| SMILES | CC(C)[C@@H]1CCCN(C(=O)Nc2ccc3oc(=O)ccc3c2)CC1 |
| InChI | InChI=1S/C19H24N2O3/c1-13(2)14-4-3-10-21(11-9-14)19(23)20-16-6-7-17-15(12-16)5-8-18(22)24-17/h5-8,12-14H,3-4,9-11H2,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | KPLCZTHZCYHJSP-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|