C14H15Cl2N5 — CID 3939622
3-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carboximidamide (PubChem CID 3939622) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carboximidamide.
| Compound Name | 3-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carboximidamide |
|---|---|
| PubChem CID | 3939622 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carboximidamide |
| SMILES | [H]/N=C(\N)n1nc(-c2ccc(Cl)c(Cl)c2)c2c1NCCCC2 |
| InChI | InChI=1S/C14H15Cl2N5/c15-10-5-4-8(7-11(10)16)12-9-3-1-2-6-19-13(9)21(20-12)14(17)18/h4-5,7,19H,1-3,6H2,(H3,17,18) |
| InChIKey | RAUVJQPEKSKAFA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|