C14H14Cl2N4S — CID 5014837
3-(2,3-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carbothioamide (PubChem CID 5014837) has the molecular formula C14H14Cl2N4S and a molecular weight of 341.27 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carbothioamide.
| Compound Name | 3-(2,3-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carbothioamide |
|---|---|
| PubChem CID | 5014837 |
| Molecular Formula | C14H14Cl2N4S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine-1-carbothioamide |
| SMILES | NC(=S)n1nc(-c2cccc(Cl)c2Cl)c2c1NCCCC2 |
| InChI | InChI=1S/C14H14Cl2N4S/c15-10-6-3-5-8(11(10)16)12-9-4-1-2-7-18-13(9)20(19-12)14(17)21/h3,5-6,18H,1-2,4,7H2,(H2,17,21) |
| InChIKey | PQDDODVAPHXKPU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|