C14H22N4S — CID 5021708
3-cyclohexyl-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide (PubChem CID 5021708) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-cyclohexyl-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide.
| Compound Name | 3-cyclohexyl-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide |
|---|---|
| PubChem CID | 5021708 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-cyclohexyl-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide |
| SMILES | NC(=S)n1nc(C2CCCCC2)c2c1NCCCC2 |
| InChI | InChI=1S/C14H22N4S/c15-14(19)18-13-11(8-4-5-9-16-13)12(17-18)10-6-2-1-3-7-10/h10,16H,1-9H2,(H2,15,19) |
| InChIKey | IXOXWMGMQQZNPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|