C15H17FN4S — CID 5027383
3-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide (PubChem CID 5027383) has the molecular formula C15H17FN4S and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide |
|---|---|
| PubChem CID | 5027383 |
| Molecular Formula | C15H17FN4S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine-1-carbothioamide |
| SMILES | NC(=S)n1nc(Cc2ccc(F)cc2)c2c1NCCCC2 |
| InChI | InChI=1S/C15H17FN4S/c16-11-6-4-10(5-7-11)9-13-12-3-1-2-8-18-14(12)20(19-13)15(17)21/h4-7,18H,1-3,8-9H2,(H2,17,21) |
| InChIKey | PXXHHNOWIZYCQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|