C13H13ClN4S — CID 3914695
3-[(2-chlorophenyl)methyl]-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide (PubChem CID 3914695) has the molecular formula C13H13ClN4S and a molecular weight of 292.79 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 3914695 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide |
| SMILES | NC(=S)n1nc(Cc2ccccc2Cl)c2c1NCC2 |
| InChI | InChI=1S/C13H13ClN4S/c14-10-4-2-1-3-8(10)7-11-9-5-6-16-12(9)18(17-11)13(15)19/h1-4,16H,5-7H2,(H2,15,19) |
| InChIKey | HJTMRJKOSTZEST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|