C25H18N2O4 — CID 3940714
[2-(1H-indol-3-yl)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 3940714) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3940714 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)c3c[nH]c4ccccc34)c3ccccc3n2)o1 |
| InChI | InChI=1S/C25H18N2O4/c1-15-10-11-24(31-15)22-12-18(16-6-3-5-9-21(16)27-22)25(29)30-14-23(28)19-13-26-20-8-4-2-7-17(19)20/h2-13,26H,14H2,1H3 |
| InChIKey | IKHXQZUEBOCTIY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |