C25H30N2O4 — CID 4031723
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 4031723) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4031723 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)N(CC(C)C)CC(C)C)c3ccccc3n2)o1 |
| InChI | InChI=1S/C25H30N2O4/c1-16(2)13-27(14-17(3)4)24(28)15-30-25(29)20-12-22(23-11-10-18(5)31-23)26-21-9-7-6-8-19(20)21/h6-12,16-17H,13-15H2,1-5H3 |
| InChIKey | APGDFEWPQXHONT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |