C18H20ClNO — CID 39425790
2-chloro-N-(2,5-dimethylphenyl)-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 39425790) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylphenyl)-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2,5-dimethylphenyl)-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 39425790 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylphenyl)-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cccc(CN(C(=O)CCl)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C18H20ClNO/c1-13-5-4-6-16(9-13)12-20(18(21)11-19)17-10-14(2)7-8-15(17)3/h4-10H,11-12H2,1-3H3 |
| InChIKey | HTPBPUZRVPRYJR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|