About 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid
1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid (PubChem CID 3942959) has the molecular formula C19H20Cl2N2O2
and a molecular weight of 379.29 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid |
| PubChem CID | 3942959 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(Cc2ccccn2)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-14-6-7-16(17(21)10-14)18(11-15-5-1-2-8-22-15)23-9-3-4-13(12-23)19(24)25/h1-2,5-8,10,13,18H,3-4,9,11-12H2,(H,24,25) |
| InChIKey | BJQHHOIOKABXQF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid?
The IUPAC name of 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid (CID 3942959) is 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid?
The canonical SMILES for 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid is O=C(O)C1CCCN(C(Cc2ccccn2)c2ccc(Cl)cc2Cl)C1.
What is the InChIKey of 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid?
The InChIKey is BJQHHOIOKABXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O2/c20-14-6-7-16(17(21)10-14)18(11-15-5-1-2-8-22-15)23-9-3-4-13(12-23)19(24)25/h1-2,5-8,10,13,18H,3-4,9,11-12H2,(H,24,25).
What are the key properties of 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid?
1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid has a molecular weight of 379.29 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 3942959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).