C17H18BrNO2 — CID 3944962
2-(4-bromo-2,5-dimethylphenoxy)-N-methyl-N-phenylacetamide (PubChem CID 3944962) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenoxy)-N-methyl-N-phenylacetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 3944962 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-methyl-N-phenylacetamide |
| SMILES | Cc1cc(OCC(=O)N(C)c2ccccc2)c(C)cc1Br |
| InChI | InChI=1S/C17H18BrNO2/c1-12-10-16(13(2)9-15(12)18)21-11-17(20)19(3)14-7-5-4-6-8-14/h4-10H,11H2,1-3H3 |
| InChIKey | MFYMTKLUHHQOMF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |