C32H31ClN4O6 — CID 3945291
N-butyl-4-chloro-N-[2-[4-(2,5-dimethoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 3945291) has the molecular formula C32H31ClN4O6 and a molecular weight of 603.08 g/mol. Its IUPAC name is N-butyl-4-chloro-N-[2-[4-(2,5-dimethoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-butyl-4-chloro-N-[2-[4-(2,5-dimethoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3945291 |
| Molecular Formula | C32H31ClN4O6 |
| Molecular Weight | 603.08 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | N-butyl-4-chloro-N-[2-[4-(2,5-dimethoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N1c2ccccc2-n2cccc2C1c1cc(OC)ccc1OC)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H31ClN4O6/c1-4-5-16-34(32(39)21-12-14-24(33)28(18-21)37(40)41)20-30(38)36-26-10-7-6-9-25(26)35-17-8-11-27(35)31(36)23-19-22(42-2)13-15-29(23)43-3/h6-15,17-19,31H,4-5,16,20H2,1-3H3 |
| InChIKey | LUKRCIGRRFZEKC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 107.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.08 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|